CAS 2121514-41-6

3-Pyridinecarboxaldehyde, 4-chloro-5-fluoro-, hydrochloride (1:1)

Description:

3-Pyridinecarboxaldehyde, 4-chloro-5-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of chlorine and fluorine substituents at the 4 and 5 positions, respectively, contributes to its unique chemical properties, including altered electronic characteristics and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and agrochemicals. The compound's molecular interactions may be influenced by the electronegative halogen atoms, which can affect its reactivity and binding affinity in biological systems. Overall, this compound is of interest for its potential applications in medicinal chemistry and as a building block in the synthesis of more complex molecules.

Formula: C₆H₃ClFNO·ClH

InChI: InChI=1S/C6H3ClFNO.ClH/c7-6-4(3-10)1-9-2-5(6)8;/h1-3H;1H

InChI key: InChIKey=SRJTUZMJFGHTOV-UHFFFAOYSA-N

SMILES: C(=O)C=1C(Cl)=C(F)C=NC1.Cl

Synonyms:

• 3-Pyridinecarboxaldehyde, 4-chloro-5-fluoro-, hydrochloride (1:1)

3-Pyridinecarboxaldehyde, 4-chloro-5-fluoro-, hydrochloride (1:1)

CAS: 2121514-41-6

Formula: C₆H₄Cl₂FNO

Purity: 96%

Molecular weight: 196.0065

Ref: IN-DA01Q93Q

4-Chloro-5-fluoro-pyridine-3-carbaldehyde hydrochloride

CAS: 2121514-41-6

Purity: ≥95%

Molecular weight: 196

Ref: 10-F631406