CAS 2121514-63-2

B-[3-(9H-Carbazol-9-yl)-5-chlorophenyl]boronic acid

Description:

B-[3-(9H-Carbazol-9-yl)-5-chlorophenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. The structure features a carbazole moiety, which contributes to its potential applications in organic electronics and photonics due to its strong luminescent properties. The presence of a chlorophenyl group enhances its reactivity and solubility in organic solvents. This compound is typically utilized in synthetic organic chemistry, especially in the development of pharmaceuticals and advanced materials. Its boronic acid functionality allows for the formation of stable complexes with biomolecules, making it of interest in medicinal chemistry and bioconjugation strategies. Overall, B-[3-(9H-Carbazol-9-yl)-5-chlorophenyl]boronic acid exhibits unique electronic properties and reactivity that make it a valuable compound in both research and industrial applications.

Formula: C₁₈H₁₃BClNO₂

InChI: InChI=1S/C18H13BClNO2/c20-13-9-12(19(22)23)10-14(11-13)21-17-7-3-1-5-15(17)16-6-2-4-8-18(16)21/h1-11,22-23H

InChI key: InChIKey=SDAVHBDIRPDTGJ-UHFFFAOYSA-N

SMILES: B(O)(O)C=1C=C(N2C=3C(C=4C2=CC=CC4)=CC=CC3)C=C(Cl)C1

Synonyms:

• B-[3-(9H-Carbazol-9-yl)-5-chlorophenyl]boronic acid
• Boronic acid, B-[3-(9H-carbazol-9-yl)-5-chlorophenyl]-

Boronic acid, B-[3-(9H-carbazol-9-yl)-5-chlorophenyl]-

CAS: 2121514-63-2

Formula: C₁₈H₁₃BClNO₂

Purity: >95%

Molecular weight: 321.5653

Ref: IN-DA01STA8

3-(9H-Carbazol-9-yl)-5-chlorophenylboronic acid

CAS: 2121514-63-2

Purity: ≥95%

Molecular weight: 321.5700073

Ref: 10-F627402