CAS 2121514-95-0

2-[2-Chloro-4-(1-methylethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:

2-[2-Chloro-4-(1-methylethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a chlorophenyl substituent. The presence of the dioxaborolane moiety suggests potential applications in organic synthesis, particularly in cross-coupling reactions, where boron compounds are often utilized as intermediates. The chlorophenyl group may enhance the compound's reactivity and solubility in organic solvents, making it suitable for various chemical transformations. Additionally, the presence of the 1-methylethoxy group contributes to the compound's steric and electronic properties, potentially influencing its reactivity and interaction with other molecules. This compound may also exhibit specific physical properties such as melting and boiling points, solubility in organic solvents, and stability under various conditions, which are essential for its practical applications in research and industry. Overall, its unique structure and functional groups position it as a valuable compound in the field of synthetic organic chemistry.

Formula: C₁₅H₂₂BClO₃

InChI: InChI=1S/C15H22BClO3/c1-10(2)18-11-7-8-12(13(17)9-11)16-19-14(3,4)15(5,6)20-16/h7-10H,1-6H3

InChI key: InChIKey=LFOMBBOEDARHTH-UHFFFAOYSA-N

SMILES: ClC1=C(C=CC(OC(C)C)=C1)B2OC(C)(C)C(C)(C)O2

Synonyms:

• 1,3,2-Dioxaborolane, 2-[2-chloro-4-(1-methylethoxy)phenyl]-4,4,5,5-tetramethyl-
• 2-[2-Chloro-4-(1-methylethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

1,3,2-Dioxaborolane, 2-[2-chloro-4-(1-methylethoxy)phenyl]-4,4,5,5-tetramethyl-

CAS: 2121514-95-0

Formula: C₁₅H₂₂BClO₃

Purity: 95%

Molecular weight: 296.5974

Ref: IN-DA01K584

2-(2-Chloro-4-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

CAS: 2121514-95-0

Purity: ≥95%

Molecular weight: 296.6000061

Ref: 10-F627497