CAS 2121515-19-1

Boronic acid, B-[3-bromo-5-[[(4-bromophenyl)amino]carbonyl]phenyl]-

Description:

Boronic acids are a class of organic compounds that contain a boron atom bonded to a hydroxyl group and an organic substituent. The specific compound "Boronic acid, B-[3-bromo-5-[[(4-bromophenyl)amino]carbonyl]phenyl]-" is characterized by its complex structure, which includes multiple functional groups such as bromine atoms and an amine group. This compound typically exhibits properties associated with boronic acids, including the ability to form reversible covalent bonds with diols, making them useful in various applications such as drug development and materials science. The presence of bromine substituents may enhance its reactivity and solubility in organic solvents. Additionally, the amine and carbonyl functionalities suggest potential for further chemical modifications and interactions. Overall, this compound's unique structure and functional groups contribute to its potential utility in synthetic chemistry and medicinal applications.

Formula: C₁₃H₁₀BBr₂NO₃

InChI: InChI=1S/C13H10BBr2NO3/c15-10-1-3-12(4-2-10)17-13(18)8-5-9(14(19)20)7-11(16)6-8/h1-7,19-20H,(H,17,18)

InChI key: InChIKey=STRKHABUROGCJC-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(Br)C=C1)(=O)C2=CC(B(O)O)=CC(Br)=C2

Synonyms:

• Boronic acid, B-[3-bromo-5-[[(4-bromophenyl)amino]carbonyl]phenyl]-

Boronic acid, B-[3-bromo-5-[[(4-bromophenyl)amino]carbonyl]phenyl]-

CAS: 2121515-19-1

Formula: C₁₃H₁₀BBr₂NO₃

Purity: 95%

Molecular weight: 398.8424

Ref: IN-DA01SWG1

5-Bromo-3-(4-bromophenylcarbamoyl)phenylboronic acid

CAS: 2121515-19-1

Purity: ≥95%

Molecular weight: 398.8500061

Ref: 10-F627427