CAS 2122-29-4
:(+)-Retamine
Description:
(+)-Retamine, with the CAS number 2122-29-4, is an alkaloid derived from the plant species of the genus *Rauvolfia*. It is characterized by its complex bicyclic structure, which includes a tetracyclic framework typical of many indole alkaloids. This compound exhibits a range of biological activities, including potential anti-inflammatory and analgesic properties, making it of interest in pharmacological research. (+)-Retamine is typically found in trace amounts in plant sources and can be isolated through various extraction and purification techniques. Its stereochemistry is significant, as the (+) designation indicates the specific optical activity of the molecule, which can influence its interaction with biological systems. The compound's solubility, stability, and reactivity can vary depending on environmental conditions and the presence of other chemical species. As with many alkaloids, safety and toxicity profiles are important considerations in its study and potential applications. Overall, (+)-Retamine represents a fascinating subject for further investigation in both natural product chemistry and medicinal applications.
Formula:C15H26N2O
InChI:InChI=1S/C15H26N2O/c18-14-5-3-7-17-9-11-8-12(15(14)17)10-16-6-2-1-4-13(11)16/h11-15,18H,1-10H2/t11-,12-,13+,14+,15+/m1/s1
InChI key:InChIKey=JMXNBIDTNISOTA-MRLBHPIUSA-N
SMILES:O[C@@H]1[C@@]2([C@@]3(C[C@](CN2CCC1)([C@]4(N(C3)CCCC4)[H])[H])[H])[H]
Synonyms:- 7,14-Methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-1-ol, dodecahydro-, [1S-(1α,7α,7aα,14α,14aβ)]-
- 7,14-Methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-1-ol, dodecahydro-, (1S,7R,7aS,14R,14aS)-
- (+)-Retamine
- Retamine
- (1S,7R,7aS,14R,14aS)-Dodecahydro-7,14-methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
