CAS 2122-61-4
:4-Amino-3,5-diiodobenzoic acid
Description:
4-Amino-3,5-diiodobenzoic acid is an organic compound characterized by the presence of an amino group and two iodine substituents on a benzoic acid framework. Its molecular structure features a benzene ring with a carboxylic acid group (-COOH) and an amino group (-NH2) attached to the aromatic system, along with two iodine atoms at the 3 and 5 positions. This compound is typically a solid at room temperature and is known for its potential applications in pharmaceuticals and as a reagent in organic synthesis. The presence of iodine atoms enhances its reactivity and can influence its biological activity. 4-Amino-3,5-diiodobenzoic acid is soluble in polar solvents, and its properties can be affected by pH, particularly due to the acidic nature of the carboxylic group. Safety data should be consulted, as iodine-containing compounds can pose health risks. Overall, this compound is of interest in various fields, including medicinal chemistry and materials science.
Formula:C7H5I2NO2
InChI:InChI=1S/C7H5I2NO2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H,10H2,(H,11,12)
InChI key:InChIKey=WXTVPMWCUMEVSZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(I)=C(N)C(I)=C1
Synonyms:- 3,5-Diiodo-4-aminobenzoic acid
- 3,5-Dijod-4-aminohippursaeure
- 3,5-Dijod-4-aminohippursaeure [German]
- 4-Amino-3,5-Diiodobenzoate
- Ai3-52265
- Benzoic acid, 4-amino-3,5-diiodo-
- Brn 2103037
- Nsc 57118
- 4-Amino-3,5-diiodobenzoic acid
- 3-14-00-01161 (Beilstein Handbook Reference)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Amino-3,5-diiodobenzoic acid
CAS:Formula:C7H5I2NO2Purity:%Color and Shape:SolidMolecular weight:388.92904-amino-3,5-diiodobenzoic acid
CAS:4-amino-3,5-diiodobenzoic acidPurity:≥95%Molecular weight:388.93g/mol4-Amino-3,5-diiodobenzoic acid
CAS:4-Amino-3,5-diiodobenzoic acid is a conjugate of the amino acid histidine with two iodine atoms. It is used as a radiopaque contrast agent for X-ray imaging and has been shown to be useful in distinguishing between normal tissue and cancerous lesions. The molecule can be modified to contain various functional groups that allow it to bind to other molecules such as proteins or DNA, which can alter its properties. 4-Amino-3,5-diiodobenzoic acid is also known as diaminobenzene diiodide and is soluble in water.Formula:C7H5I2NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:388.93 g/mol



