CymitQuimica logo

CAS 212262-02-7

:

S-(13,13-dioxido-3,6,9-trioxa-12,13-dithiatetradec-1-yl) methanesulfonothioate (non-preferred name)

Description:
S-(13,13-dioxido-3,6,9-trioxa-12,13-dithiatetradec-1-yl) methanesulfonothioate, identified by its CAS number 212262-02-7, is a chemical compound characterized by its complex molecular structure, which includes multiple functional groups such as dioxides, thioates, and ether linkages. This compound features a long carbon chain, contributing to its potential applications in various fields, including materials science and pharmaceuticals. The presence of sulfur and oxygen in its structure suggests that it may exhibit unique chemical reactivity and properties, such as potential antioxidant activity or interactions with biological systems. Additionally, the methanesulfonothioate group indicates that it may have applications in organic synthesis or as a reagent in chemical reactions. However, specific information regarding its physical properties, such as solubility, melting point, and stability, would require further empirical investigation. As with many specialized chemical substances, safety data and handling precautions are essential for its use in laboratory or industrial settings.
Formula:C10H22O7S4
InChI:InChI=1/C10H22O7S4/c1-20(11,12)18-9-7-16-5-3-15-4-6-17-8-10-19-21(2,13)14/h3-10H2,1-2H3
SMILES:CS(=O)(=O)SCCOCCOCCOCCSS(=O)(=O)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.