CAS 212262-04-9

Methanesulfonothioic acid, S,S′-[1,2-ethanediylbis(oxy-2,1-ethanediyl)] ester

Description:

Methanesulfonothioic acid, S,S′-[1,2-ethanediylbis(oxy-2,1-ethanediyl)] ester, identified by CAS number 212262-04-9, is a chemical compound characterized by its unique structure that includes a methanesulfonothioic acid moiety linked to an ether group derived from ethylene glycol. This compound typically exhibits properties associated with both sulfonic acids and esters, such as high solubility in polar solvents and potential reactivity with nucleophiles due to the presence of the sulfonothioic acid functional group. Its ester linkage suggests that it may undergo hydrolysis under certain conditions, releasing methanesulfonothioic acid and an alcohol. The compound may also possess biological activity, making it of interest in various fields, including medicinal chemistry and agrochemicals. However, specific safety and handling information should be consulted, as compounds with sulfonic acid derivatives can exhibit toxicity or irritant properties. Overall, the compound's characteristics make it a subject of interest for further research and application in chemical synthesis and industrial processes.

Formula: C₈H₁₈O₆S₄

InChI: InChI=1/C8H18O6S4/c1-17(9,10)15-7-5-13-3-4-14-6-8-16-18(2,11)12/h3-8H2,1-2H3

InChI key: InChIKey=LXWJSGGRYYFDPB-UHFFFAOYSA-N

SMILES: S(S(C)(=O)=O)CCOCCOCCSS(C)(=O)=O

Synonyms:

• Methanesulfonothioic acid, S,S′-[1,2-ethanediylbis(oxy-2,1-ethanediyl)] ester

3,6-Dioxaoctane-1,8-diyl Bismethanethiosulfonate

Controlled Product

CAS: 212262-04-9

Stability Moisture Sensitive
Applications A sulfhydryl cross-linking reagent.
References Loo, T.W. and Clark, D.M.: J. Biol. Chem., 276, 40, 36877 (2001)

Formula: C₈H₁₈O₆S₄

Color and Shape: Off-White

Molecular weight: 338.48

Ref: TR-D486150