CAS 212262-08-3
:1-[2-(2-methylsulfanylsulfonylethoxy)ethoxy]-2-[2-(2-methylsulfonylsulfanylethoxy)ethoxy]ethane
Description:
The chemical substance known as "1-[2-(2-methylsulfanylsulfonylethoxy)ethoxy]-2-[2-(2-methylsulfonylsulfanylethoxy)ethoxy]ethane," with the CAS number 212262-08-3, is a complex organic compound characterized by its multi-functional ether and sulfonyl groups. It features a symmetrical structure with two ethoxy groups attached to a central ethane backbone, which contributes to its potential solubility in organic solvents. The presence of methylsulfanylsulfonyl and methylsulfonylsulfanylethoxy moieties suggests that the compound may exhibit interesting chemical reactivity and biological activity, possibly influencing its interactions in various chemical environments. Such compounds often serve as intermediates in organic synthesis or may have applications in pharmaceuticals or agrochemicals due to their unique functional groups. The specific properties, such as melting point, boiling point, and solubility, would require experimental determination or detailed literature references for precise characterization. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.
Formula:C12H26O8S4
InChI:InChI=1/C12H26O8S4/c1-21-24(15,16)12-10-20-8-6-18-4-3-17-5-7-19-9-11-22-23(2,13)14/h3-12H2,1-2H3
SMILES:CSS(=O)(=O)CCOCCOCCOCCOCCSS(=O)(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,6,9,12-Tetraoxatetradecane-1,14-diyl-bis-methanethiosulfonate
CAS:Formula:C12H26O8S4Color and Shape:LiquidMolecular weight:426.59
