CAS 21230-50-2

3-amino-1-methyl-1H-pyrazole-4-carbonitrile

Description:

3-Amino-1-methyl-1H-pyrazole-4-carbonitrile is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a cyano group (-C≡N) attached to the pyrazole ring, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the methyl group enhances its lipophilicity, which can influence its biological activity and solubility. As a heterocyclic compound, it exhibits properties typical of pyrazoles, such as the ability to form hydrogen bonds and participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Its CAS number, 21230-50-2, allows for easy identification in chemical databases. Overall, 3-amino-1-methyl-1H-pyrazole-4-carbonitrile is of interest for its potential utility in drug development and as a building block in synthetic organic chemistry.

Formula: C₅H₆N₄

InChI: InChI=1/C5H6N4/c1-9-3-4(2-6)5(7)8-9/h3H,1H3,(H2,7,8)

SMILES: Cn1cc(C#N)c(=N)[nH]1

Synonyms:

• 1H-pyrazole-4-carbonitrile, 3-amino-1-methyl-

1-Methyl-3-amino-4-cyanopyrazole

CAS: 21230-50-2

Formula: C₅H₆N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 122.1279

Ref: IN-DA00BG3A

1-Methyl-3-amino-4-cyanopyrazole

CAS: 21230-50-2

1-Methyl-3-amino-4-cyanopyrazole (compound 3) is a molecule used in the synthesis of adenosine A3 receptor antagonists.

Formula: C₅H₆N₄

Purity: 99.799%

Color and Shape: Solid

Molecular weight: 122.13

Ref: TM-T203352

1-Methyl-3-amino-4-cyanopyrazole

CAS: 21230-50-2

1-Methyl-3-amino-4-cyanopyrazole

Purity: 95%

Molecular weight: 122.13g/mol

Ref: 54-OR905717

3-Amino-1-methyl-1H-pyrazole-4-carbonitrile

CAS: 21230-50-2

Formula: C₅H₆N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 122.131

Ref: 10-F068660