CAS 212322-56-0: N-[3-Amino-4-(methylamino)benzoyl]-N-2-pyridinyl-β-alanine ethyl ester
Description:N-[3-Amino-4-(methylamino)benzoyl]-N-2-pyridinyl-β-alanine ethyl ester, with the CAS number 212322-56-0, is a chemical compound characterized by its complex structure that includes an amino acid derivative and a pyridine moiety. This compound typically exhibits properties such as solubility in polar solvents, which is common for amino acid derivatives, and may possess biological activity due to the presence of functional groups that can participate in hydrogen bonding and other interactions. The presence of both an amine and an ester functional group suggests potential reactivity, making it of interest in medicinal chemistry and drug development. Its structural features may allow it to interact with biological targets, potentially influencing its pharmacological properties. Additionally, the compound's stability, reactivity, and specific applications would depend on its synthesis and the conditions under which it is used. Overall, this compound represents a class of molecules that can be explored for various applications in biochemistry and pharmaceuticals.
Formula:C18H22N4O3
InChI:InChI=1S/C18H22N4O3/c1-3-25-17(23)9-11-22(16-6-4-5-10-21-16)18(24)13-7-8-15(20-2)14(19)12-13/h4-8,10,12,20H,3,9,11,19H2,1-2H3
InChI key:InChIKey=PCPATNZTKBOKOY-UHFFFAOYSA-N
SMILES:O=C(OCC)CCN(C1=NC=CC=C1)C(=O)C2=CC=C(NC)C(N)=C2
- Synonyms:
- 3-[(3-Amino-4-Methylamino-Benzoyl)-Pyridin-2-Yl-Amino]-Propionic Acid Ethyl Ester
- 3-[(3-Amino-4-methyl aminobenzoyl)pyridin-2-ylamino]propionic acid ethyl ester
- 3-[(3-Amino-4-methylaminobenzoyl)pyridin-2-ylamino]propionic acid ethyl ester
- 3-[3-Amino-4-(Methylaminobenzoyl)-Pyridin-2-Ylamni]Propionic Acid Ethyl Ester
- Alanine,N-[3-amino-4-(methylamino)benzoyl]-N-2-pyridinyl-,ethyl ester
- Dabigatran etexilate intermediates
- Dabigatran intermediates
- Ethyl 3-(3-amino-4-(methylamino)-N-(pyridin-2-yl)benzamido)propanoate
- Ethyl 3-[(3-amino-4-methylaminobenzoyl)-(pyridin-2-yl)-amino]propanoate
- Ethyl 3-[3-amino-4-(methylamino)-N-(pyridin-2-yl)benzoylamino]propanoate
- See more synonyms
- Ethyl 3-[[3-amino-4-(methylamino)benzoyl](pyridin-2-yl)amino]propionate
- Ethyl 3-[[3-amino-4-(methylamino)benzoyl]-pyridin-2-ylamino]propanoate
- N-[3-amino-4-(methylamino)benzoyl]-N-2-pyridinyl-beta-Alanine ethyl ester
- N-[3-amino-4-(methylamino)benzoyl]-N-2-pyridinyl-β-alanine, ethyl ester
- b-Alanine, N-[3-amino-4-(methylamino)benzoyl]-N-2-pyridinyl-, ethyl ester