CAS 212333-72-7
:N,N,N',N'-Tetramethyl-S-(1-oxido-2-pyridyl)thiuronium hexafluorophosphate
Description:
N,N,N',N'-Tetramethyl-S-(1-oxido-2-pyridyl)thiuronium hexafluorophosphate is a chemical compound characterized by its unique structure, which includes a thiuronium core substituted with a pyridyl group and a hexafluorophosphate counterion. This compound typically exhibits properties associated with ionic salts, such as high solubility in polar solvents and potential stability under ambient conditions. The presence of the pyridyl moiety may impart specific reactivity, particularly in coordination chemistry or as a ligand in various catalytic processes. The hexafluorophosphate anion is known for its ability to stabilize cations and enhance solubility in organic solvents. Additionally, the compound may exhibit interesting electrochemical properties, making it relevant in fields such as organic synthesis and materials science. Its application could extend to areas like ionic liquids or as a reagent in organic transformations, although specific applications would depend on its reactivity and stability under various conditions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
InChI:InChI=1/C10H16N3OS.F6P/c1-11(2)10(12(3)4)15-9-7-5-6-8-13(9)14;1-7(2,3,4,5)6/h5-8H,1-4H3;/q+1;-1
Synonyms:- Hott
- N-{(dimethylamino)[(1-oxidopyridin-2-yl)sulfanyl]methylidene}-N-methylmethanaminium hexafluorophosphate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N,N,N',N'-Tetramethyl-S-(1-oxido-2-pyridyl)thiouronium Hexafluorophosphate
CAS:Formula:C10H16F6N3OPSPurity:>98.0%(HPLC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:371.28N,N,N,N-Tetramethyl-S-(1-Oxido-2-Pyridyl)Thiuronium Hexafluorophosphate
CAS:Formula:C10H16F6N3OPSPurity:98%Color and Shape:SolidMolecular weight:371.2827N,N,N',N'-Tetramethyl-S-(1-oxido-2-pyridyl)thiouronium hexafluorophosphate
CAS:N,N,N',N'-Tetramethyl-S-(1-oxido-2-pyridyl)thiouronium hexafluorophosphatePurity:98%Molecular weight:371.28g/molHOTT
CAS:HOTT is a uronium salt used as a coupling reagent in the synthesis of peptides, primary amides, hydroxamates, Weinreb amides and Barton esters. HOTT is used in presence of Hünig's base, is soluble in DMF, finds application in solid phase and in solution synthesis and achieves high yields with low levels of racemisation, at an affordable cost. HOTT can form labile Barton esters in the presence of triethylamine afrom hindered or difficult carboxylic acids.
Formula:C10H16N3OS•F6PPurity:Min. 95%Color and Shape:White/Off-White SolidMolecular weight:371.28 g/mol




