CAS 2124-47-2

2,4-dimethyl-5-nitroaniline

Description:

2,4-Dimethyl-5-nitroaniline is an organic compound characterized by its aromatic amine structure, featuring two methyl groups and a nitro group attached to a benzene ring. The presence of the nitro group at the 5-position and the two methyl groups at the 2 and 4 positions contributes to its unique chemical properties. This compound is typically a solid at room temperature and is known for its yellow to orange color, which can vary based on purity and specific conditions. It is moderately soluble in organic solvents but has limited solubility in water. 2,4-Dimethyl-5-nitroaniline is primarily used in the synthesis of dyes, pigments, and other chemical intermediates. As with many nitroanilines, it may pose health risks, including potential toxicity and environmental hazards, necessitating careful handling and disposal. Its reactivity can be influenced by the presence of the nitro group, which can participate in various chemical reactions, including reduction and electrophilic substitution.

Formula: C₈H₁₀N₂O₂

InChI: InChI=1/C8H10N2O2/c1-5-3-6(2)8(10(11)12)4-7(5)9/h3-4H,9H2,1-2H3

SMILES: Cc1cc(C)c(cc1N)N(=O)=O

Synonyms:

• Benzenamine, 2,4-Dimethyl-5-Nitro-
• Zr B1 D1 Enw [Wln]

2,4-Dimethyl-5-nitroaniline

CAS: 2124-47-2

Formula: C₈H₁₀N₂O₂

Purity: >98.0%(GC)(T)

Color and Shape: Light yellow to Brown powder to crystal

Molecular weight: 166.18

Ref: 3B-D5196

2,4-Dimethyl-5-nitroaniline

CAS: 2124-47-2

Formula: C₈H₁₀N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 166.1772

Ref: IN-DA007ON5

2,4-Dimethyl-5-nitroaniline

CAS: 2124-47-2

2,4-Dimethyl-5-nitroaniline

Formula: C₈H₁₀N₂O₂

Purity: tech

Color and Shape: orange powder

Molecular weight: 166.18g/mol

Ref: 54-OR6966

2,4-Dimethyl-5-nitroaniline

CAS: 2124-47-2

Formula: C₈H₁₀N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 166.18

Ref: 10-F209420