CAS 21241-41-8

[(tricyclo[3.3.1.1~3,7~]dec-1-ylcarbonyl)amino]acetate

Description:

The chemical substance known as [(tricyclo[3.3.1.1^3,7]dec-1-ylcarbonyl)amino]acetate, with the CAS number 21241-41-8, is a complex organic compound characterized by its unique tricyclic structure. This compound features a tricyclodecane framework, which contributes to its rigidity and potential steric effects. The presence of an amino group and an acetate moiety indicates that it may exhibit both basic and acidic properties, allowing for potential interactions in biological systems. Its carbonyl group suggests reactivity typical of amides or esters, which could be relevant in synthetic applications or biological activity. The compound's structural complexity may influence its solubility, stability, and reactivity, making it of interest in fields such as medicinal chemistry or materials science. Overall, the unique arrangement of its functional groups and the tricyclic core provide a foundation for exploring its chemical behavior and potential applications.

Formula: C₁₃H₁₈NO₃

InChI: InChI=1/C13H19NO3/c15-11(16)7-14-12(17)13-4-8-1-9(5-13)3-10(2-8)6-13/h8-10H,1-7H2,(H,14,17)(H,15,16)/p-1

SMILES: C1C2CC3CC1CC(C2)(C3)C(=NCC(=O)[O-])O

2-(Adamantan-1-ylformamido)acetic acid

CAS: 21241-41-8

Versatile small molecule scaffold

Formula: C₁₃H₁₉NO₃

Purity: Min. 95%

Molecular weight: 237.29 g/mol

Ref: 3D-WAA24141