CAS 21243-09-4

3-[(2-fluorophenyl)sulfanyl]propanoic acid

Description:

3-[(2-Fluorophenyl)sulfanyl]propanoic acid, with the CAS number 21243-09-4, is an organic compound characterized by the presence of a propanoic acid moiety attached to a sulfanyl group linked to a 2-fluorophenyl ring. This compound features a sulfur atom that connects the propanoic acid to the aromatic ring, which introduces unique chemical properties due to the electron-withdrawing effect of the fluorine substituent on the phenyl group. The presence of the carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions, potentially acting as a weak acid. The fluorine atom can influence the compound's reactivity, solubility, and biological activity. Additionally, the overall structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of such compounds to interact with biological targets. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups.

Formula: C₉H₉FO₂S

InChI: InChI=1/C9H9FO2S/c10-7-3-1-2-4-8(7)13-6-5-9(11)12/h1-4H,5-6H2,(H,11,12)

SMILES: c1ccc(c(c1)F)SCCC(=O)[O-]

3-(2-fluorophenyl)sulfanylpropanoate

CAS: 21243-09-4

Formula: C₉H₉FO₂S

Purity: 97%

Molecular weight: 200.2300

Ref: IN-DA006Y2V

3-[(2-fluorophenyl)sulfanyl]propanoic acid

CAS: 21243-09-4

3-[(2-fluorophenyl)sulfanyl]propanoic acid

Purity: 97%

Molecular weight: 200.23g/mol

Ref: 54-PC100473

3-[(2-fluorophenyl)thio]propanoic acid

CAS: 21243-09-4

Formula: C₉H₉FO₂S

Purity: 97%

Molecular weight: 200.23

Ref: 10-F349041