CAS 21243-20-9

4H-1-Benzothiopyran-4-one, 8-fluoro-2,3-dihydro-, 1,1-dioxide

Description:

4H-1-Benzothiopyran-4-one, 8-fluoro-2,3-dihydro-, 1,1-dioxide, identified by CAS number 21243-20-9, is a heterocyclic organic compound characterized by its benzothiopyran structure, which incorporates a thiophene ring fused to a benzene ring. This compound features a fluorine atom at the 8-position and a dioxo functional group, contributing to its unique chemical properties. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its reactivity, making it of interest in medicinal chemistry and material science. The dioxo group may impart stability and alter the electronic characteristics of the molecule. Typically, compounds of this class exhibit biological activity, and their derivatives are often explored for potential pharmaceutical applications. The compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of substituents. Overall, 4H-1-Benzothiopyran-4-one, 8-fluoro-2,3-dihydro-, 1,1-dioxide represents a structurally interesting compound with potential applications in various fields of chemistry.

Formula: C₉H₇FO₃S

InChI: InChI=1S/C9H7FO3S/c10-7-3-1-2-6-8(11)4-5-14(12,13)9(6)7/h1-3H,4-5H2

InChI key: InChIKey=GGROUAVJFZEUQS-UHFFFAOYSA-N

SMILES: O=S1(=O)C=2C(C(=O)CC1)=CC=CC2F

Synonyms:

• 4H-1-Benzothiopyran-4-one, 8-fluoro-2,3-dihydro-, 1,1-dioxide
• Thiochroman-4-one, 8-fluoro-, 1,1-dioxide

8-​Fluoro-​2,​3-​dihydro-4H-​1-​benzothiopyran-​4-​one 1,​1-​dioxide

CAS: 21243-20-9

Versatile small molecule scaffold

Formula: C₉H₇FO₃S

Purity: Min. 95%

Molecular weight: 214.22 g/mol

Ref: 3D-WAA24320