CAS 21248-45-3
:(2,6-Dichlorophenylthio)acetic acid
Description:
(2,6-Dichlorophenylthio)acetic acid, with the CAS number 21248-45-3, is an organic compound characterized by its unique structure, which includes a dichlorophenyl group and a thioether functional group attached to an acetic acid moiety. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of chlorine atoms in the phenyl ring enhances its reactivity and may influence its biological activity. The thioether linkage contributes to its chemical properties, potentially affecting solubility and stability. As an acetic acid derivative, it can participate in various chemical reactions, including esterification and nucleophilic substitutions. Safety data sheets should be consulted for handling and storage guidelines, as compounds with halogenated groups can exhibit toxicity or environmental hazards. Overall, (2,6-Dichlorophenylthio)acetic acid is a compound of interest for research and development due to its distinctive chemical characteristics.
Formula:C8H6Cl2O2S
InChI:InChI=1/C8H6Cl2O2S/c9-5-2-1-3-6(10)8(5)13-4-7(11)12/h1-3H,4H2,(H,11,12)
SMILES:c1cc(c(c(c1)Cl)SCC(=O)O)Cl
Synonyms:- [(2,6-Dichlorophenyl)Sulfanyl]Acetate
- [(2,6-Dichlorophenyl)Sulfanyl]Acetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2,6-Dichlorophenylthio)acetic acid, 99%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H5Cl2O2SPurity:99%Color and Shape:Crystalline solid, WhiteMolecular weight:236.09(2,6-Dichlorophenylthio)acetic acid
CAS:<p>Versatile small molecule scaffold</p>Formula:C8H6Cl2O2SPurity:Min. 95%Molecular weight:237.11 g/mol



