CAS 21256-15-5

(2,4-diphenyl-1,3-thiazol-5-yl)acetic acid

Description:

(2,4-Diphenyl-1,3-thiazol-5-yl)acetic acid is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features two phenyl groups attached to the thiazole ring, contributing to its aromatic properties and potential for various interactions. The acetic acid functional group provides acidic characteristics, allowing it to participate in acid-base reactions. The presence of the thiazole moiety suggests potential biological activity, as thiazole derivatives are often explored for their pharmacological properties. This compound may exhibit solubility in organic solvents, while its acidic nature could influence its solubility in aqueous environments. Additionally, the structural complexity may lead to interesting reactivity patterns, making it a candidate for further research in medicinal chemistry or material science. Overall, (2,4-diphenyl-1,3-thiazol-5-yl)acetic acid represents a unique combination of functional groups that may offer diverse applications in various fields of chemistry.

Formula: C₁₇H₁₃NO₂S

InChI: InChI=1/C17H13NO2S/c19-15(20)11-14-16(12-7-3-1-4-8-12)18-17(21-14)13-9-5-2-6-10-13/h1-10H,11H2,(H,19,20)

SMILES: c1ccc(cc1)c1c(CC(=O)O)sc(c2ccccc2)n1

2-(2,4-DIPHENYL-1,3-THIAZOL-5-YL)ACETIC ACID

CAS: 21256-15-5

Formula: C₁₇H₁₃NO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 295.3556

Ref: IN-DA00BD56

2-(2,4-Diphenylthiazol-5-yl)acetic acid

CAS: 21256-15-5

Purity: 95.0%

Molecular weight: 295.3599853515625

Ref: 10-F449033