CymitQuimica logo

CAS 212616-56-3

:

(3S,4S,5S,6R)-6-[[4-(4-fluorophenyl)-2,6-diisopropyl-5-[(E,3S,5R)-3,5,7-trihydroxy-7-oxo-hept-1-enyl]-3-pyridyl]methoxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid

Description:
The chemical substance with the name "(3S,4S,5S,6R)-6-[[4-(4-fluorophenyl)-2,6-diisopropyl-5-[(E,3S,5R)-3,5,7-trihydroxy-7-oxo-hept-1-enyl]-3-pyridyl]methoxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid" and CAS number "212616-56-3" is a complex organic molecule characterized by multiple functional groups and stereocenters. It features a tetrahydropyran ring, which is a six-membered cyclic ether, and contains several hydroxyl (-OH) groups that contribute to its hydrophilicity and potential biological activity. The presence of a carboxylic acid group (-COOH) indicates acidic properties, while the fluorophenyl and diisopropyl substituents suggest lipophilic characteristics that may influence its solubility and interaction with biological membranes. The molecule's stereochemistry, denoted by the specific configuration at various chiral centers, is crucial for its biological activity and interaction with enzymes or receptors. Overall, this compound may exhibit significant pharmacological properties, making it of interest in medicinal chemistry and drug development.
Formula:C31H40FNO11
InChI:InChI=1/C31H40FNO11/c1-14(2)24-20(10-9-18(34)11-19(35)12-22(36)37)23(16-5-7-17(32)8-6-16)21(25(33-24)15(3)4)13-43-31-28(40)26(38)27(39)29(44-31)30(41)42/h5-10,14-15,18-19,26-29,31,34-35,38-40H,11-13H2,1-4H3,(H,36,37)(H,41,42)/b10-9+/t18-,19-,26+,27+,28+,29?,31-/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.