CAS 2126176-89-2

Pyrazolo[1,5-a]pyrazine, 2-cyclopropyl-4,5,6,7-tetrahydro-, hydrochloride (1:1)

Description:

Pyrazolo[1,5-a]pyrazine, 2-cyclopropyl-4,5,6,7-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazolo and pyrazine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the cyclopropyl group contributes to its structural complexity and may influence its pharmacological properties. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in various applications, including drug formulation. The compound's molecular interactions, stability, and reactivity can be influenced by the presence of the hydrochloride group, which can also affect its bioavailability. Overall, this substance may be explored for its potential therapeutic applications, particularly in areas related to neuropharmacology or other fields where pyrazole derivatives have shown promise.

Formula: C₉H₁₃N₃·ClH

InChI: InChI=1S/C9H13N3.ClH/c1-2-7(1)9-5-8-6-10-3-4-12(8)11-9;/h5,7,10H,1-4,6H2;1H

InChI key: InChIKey=DXRSRWCOJLWQCF-UHFFFAOYSA-N

SMILES: C=1(C=C2N(N1)CCNC2)C3CC3.Cl

Synonyms:

• Pyrazolo[1,5-a]pyrazine, 2-cyclopropyl-4,5,6,7-tetrahydro-, hydrochloride (1:1)

2-Cyclopropyl-4H,5H,6H,7H-pyrazolo[1,5-a]pyrazine hydrochloride

CAS: 2126176-89-2

Versatile small molecule scaffold

Formula: C₉H₁₄ClN₃

Purity: Min. 95%

Molecular weight: 199.68 g/mol

Ref: 3D-BKD17689