CAS 21262-05-5

2-Chloro-N-(4-chlorophenyl)propanamide

Description:

2-Chloro-N-(4-chlorophenyl)propanamide is an organic compound characterized by its amide functional group and the presence of chlorine substituents. It features a propanamide backbone, where a chlorine atom is attached to the second carbon of the propanamide chain, and another chlorine atom is located on the para position of a phenyl ring. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic structure. The presence of chlorine atoms enhances its reactivity and can influence its biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure contributes to its potential applications in various chemical syntheses and as an intermediate in the production of other compounds. Safety data should be consulted for handling, as chlorine-containing compounds can pose health risks. Overall, 2-Chloro-N-(4-chlorophenyl)propanamide is a notable compound in organic chemistry with specific characteristics that warrant further investigation in various fields.

Formula: C₉H₉Cl₂NO

InChI: InChI=1S/C9H9Cl2NO/c1-6(10)9(13)12-8-4-2-7(11)3-5-8/h2-6H,1H3,(H,12,13)

InChI key: InChIKey=LARDKNUATHUMFI-UHFFFAOYSA-N

SMILES: N(C(C(C)Cl)=O)C1=CC=C(Cl)C=C1

Synonyms:

• Propionanilide, 2,4′-dichloro-
• Propanamide, 2-chloro-N-(4-chlorophenyl)-
• 2-Chloro-N-(4-chlorophenyl)propanamide

2-Chloro-N-(4-Chlorophenyl)propanamide

CAS: 21262-05-5

2-Chloro-N-(4-Chlorophenyl)propanamide

Purity: ≥95%

Molecular weight: 218.08g/mol

Ref: 54-OR311097

2-Chloro-N-(4-chlorophenyl)propanamide

CAS: 21262-05-5

2-Chloro-N-(4-chlorophenyl)propanamide is an acetanilide that is used as a research chemical in the preparation of other compounds. It also has been used to synthesize chloroacetanilides and chloroanilides. 2-Chloro-N-(4-chlorophenyl)propanamide can be prepared by reacting 4-chloroaniline with acetic anhydride and potassium chloride in a basic solution. The reaction will take place at room temperature, but will produce a greater yield when heated to 40°C for 1 hour. This compound can be used as a starting material for the synthesis of other compounds, such as chlorinated analogues of acetaminophen (paracetamol).

Formula: C₉H₉Cl₂NO

Purity: Min. 95%

Molecular weight: 218.08 g/mol

Ref: 3D-FC113988

2-Chloro-N-(4-chlorophenyl)propanamide

CAS: 21262-05-5

Formula: C₉H₉Cl₂NO

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 218.08

Ref: 10-F068057