
CAS 21262-10-2
:(2R)-2-chloro-N-(4-methoxyphenyl)propanamide
Description:
(2R)-2-chloro-N-(4-methoxyphenyl)propanamide, with the CAS number 21262-10-2, is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a chlorine atom at the second carbon position and a methoxy-substituted phenyl group at the nitrogen atom contributes to its unique chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic ring. The chirality at the second carbon indicates that it exists as a specific enantiomer, which can influence its biological activity and interactions. Its structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific biological targets. Additionally, the presence of the methoxy group can enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. As with many chlorinated compounds, it may also exhibit unique reactivity patterns in organic synthesis.
Formula:C10H12ClNO2
InChI:InChI=1/C10H12ClNO2/c1-7(11)10(13)12-8-3-5-9(14-2)6-4-8/h3-7H,1-2H3,(H,12,13)/t7-/m1/s1
SMILES:C[C@H](C(=O)Nc1ccc(cc1)OC)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Chloro-N-(4-methoxyphenyl)propanamide
CAS:<p>2-Chloro-N-(4-methoxyphenyl)propanamide (2CMPP) is an acetanilide with a chloro substituent. It is used in research and yields better results than 2-chlorobenzoyl chloride. Acetanilides are prepared by the catalytic reduction of nitrobenzenes or chlorobenzenes with sodium or potassium borohydride in the presence of water. The reaction is exothermic and produces a white solid, which can be purified by recrystallization or column chromatography. Preparative methods for acetanilides include reaction of phenols with acetic anhydride and formaldehyde, followed by hydrolysis of the resulting ester to yield the corresponding amide.</p>Formula:C10H12ClNO2Purity:Min. 95%Molecular weight:213.66 g/mol
