CAS 21263-59-2
:3-(prop-2-en-1-yl)-2-thioxo-2,3-dihydroquinazolin-4(1H)-one
Description:
3-(Prop-2-en-1-yl)-2-thioxo-2,3-dihydroquinazolin-4(1H)-one, with the CAS number 21263-59-2, is a chemical compound that belongs to the class of quinazolinones, which are known for their diverse biological activities. This compound features a thioxo group, contributing to its reactivity and potential pharmacological properties. The presence of the prop-2-en-1-yl substituent indicates that it has an alkene functionality, which may enhance its reactivity in various chemical reactions, such as polymerization or addition reactions. The quinazolinone core structure is often associated with compounds that exhibit antimicrobial, anti-inflammatory, and anticancer activities. In terms of physical properties, compounds of this class may be characterized by moderate solubility in organic solvents and varying stability under different conditions. The specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods. Overall, this compound represents a potentially interesting scaffold for further research in medicinal chemistry and drug development.
Formula:C11H10N2OS
InChI:InChI=1/C11H10N2OS/c1-2-7-13-10(14)8-5-3-4-6-9(8)12-11(13)15/h2-6H,1,7H2,(H,12,15)
SMILES:C=CCn1c(=O)c2ccccc2nc1S
Synonyms:- 3-Allyl-2-sulfanylquinazolin-4(3H)-one
- 3-Allyl-2-Thioxo-1,2,3,4-Tetrahydroquinazolin-4-One
- 3-Allyl-2-thioxo-2,3-dihydroquinazolin-4(1H)-one
- 4(1H)-Quinazolinone, 2,3-dihydro-3-(2-propen-1-yl)-2-thioxo-
- 4(3H)-Quinazolinone, 2-mercapto-3-(2-propen-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
