CAS 212631-67-9: PD184161
Description:PD184161, with the CAS number 212631-67-9, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its role as a selective inhibitor of certain protein kinases. This compound is characterized by its ability to modulate specific signaling pathways, making it a subject of interest in cancer research and other therapeutic areas. PD184161 is known for its relatively high potency and selectivity, which can lead to reduced off-target effects compared to less selective inhibitors. Its chemical structure typically includes functional groups that contribute to its binding affinity and biological activity. Additionally, PD184161 has been studied for its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion (ADME), which are crucial for evaluating its potential as a therapeutic agent. Overall, PD184161 represents a valuable tool in the exploration of targeted therapies, particularly in the context of diseases driven by aberrant kinase activity.
Formula:C17H13BrClF2IN2O2
InChI:InChI=1S/C17H13BrClF2IN2O2/c18-11-6-10(17(25)24-26-7-8-1-2-8)16(15(21)14(11)20)23-13-4-3-9(22)5-12(13)19/h3-6,8,23H,1-2,7H2,(H,24,25)
InChI key:InChIKey=VJNZMSLGVUSPCF-UHFFFAOYSA-N
SMILES:O=C(NOCC1CC1)C2=CC(Br)=C(F)C(F)=C2NC3=CC=C(I)C=C3Cl
