CAS 212631-79-3: 2-(2-Chloro-4-iodophenylamino)-N-(cyclopropylmethoxy)-3,4-difluorobenzamide
Description:2-(2-Chloro-4-iodophenylamino)-N-(cyclopropylmethoxy)-3,4-difluorobenzamide, with CAS number 212631-79-3, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups. This compound features a benzamide core, which is substituted with a chloro and an iodo group on the phenyl ring, contributing to its potential biological activity. The presence of a cyclopropylmethoxy group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, the difluorobenzamide moiety may impart unique electronic characteristics, affecting its reactivity and interactions with biological targets. The compound is likely to exhibit specific solubility and stability profiles, influenced by its halogen substituents and the cyclopropyl group. Such structural features suggest that it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific pathways or diseases. However, detailed studies would be necessary to fully elucidate its properties, including its biological activity, toxicity, and potential applications.
Formula:C17H14ClF2IN2O2
InChI:InChI=1/C17H14ClF2IN2O2/c18-12-7-10(21)3-6-14(12)22-16-11(4-5-13(19)15(16)20)17(24)23-25-8-9-1-2-9/h3-7,9,22H,1-2,8H2,(H,23,24)
- Synonyms:
- Pd184352
- Ci1040
- 2-[(2-Chloro-4-iodophenyl)amino]-N-(cyclopropylmethoxy)-3,4-difluorobenzamide