CAS 212650-43-6

4-(tert-Butoxycarbonyl)morpholine-3-carboxylic acid

Description:

4-(tert-Butoxycarbonyl)morpholine-3-carboxylic acid is a chemical compound characterized by its morpholine ring structure, which is a six-membered heterocyclic amine containing one nitrogen atom. This compound features a tert-butoxycarbonyl (Boc) protecting group, commonly used in organic synthesis to protect amines during chemical reactions. The presence of a carboxylic acid functional group contributes to its acidity and reactivity, making it useful in various synthetic applications, particularly in peptide synthesis and medicinal chemistry. The morpholine moiety imparts unique properties, such as the ability to form hydrogen bonds, which can influence solubility and interaction with biological targets. Additionally, the compound's structure allows for potential modifications, making it versatile in drug design. Its CAS number, 212650-43-6, is a unique identifier that facilitates the tracking and referencing of this specific chemical in scientific literature and databases. Overall, this compound is significant in the field of organic chemistry and pharmaceutical development due to its functional groups and structural characteristics.

Formula: C₁₀H₁₇NO₅

InChI: InChI=1S/C10H17NO5/c1-10(2,3)16-9(14)11-4-5-15-6-7(11)8(12)13/h7H,4-6H2,1-3H3,(H,12,13)

InChI key: InChIKey=KVXXEKIGMOEPSA-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C(C(O)=O)COCC1

Synonyms:

• (3R)-4-(tert-butoxycarbonyl)morpholine-3-carboxylate
• (3S)-4-(tert-butoxycarbonyl)morpholine-3-carboxylate
• 3,4-Morpholinedicarboxylic acid, 4-(1,1-dimethylethyl) ester
• 4-(tert-Butoxycarbonyl)morpholine-3-carboxylic acid
• 4-Boc-morpholine-3-carboxylic acid
• 4-[[(1,1-Dimethylethyl)oxy]carbonyl]-3-morpholinecarboxylic acid
• Morpholine-3,4-dicarboxylic acid 4-tert-butyl ester
• (S)-4-(tert-butoxycarbonyl)morpholine-3-carboxylic acid
• N-Boc-morpholine-3-carboxylic acid

4-Boc-3-Morpholinecarboxylic acid

CAS: 212650-43-6

Formula: C₁₀H₁₇NO₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 231.2457

Ref: IN-DA003KUA

4-Boc-3-Morpholinecarboxylic acid

CAS: 212650-43-6

4-Boc-3-Morpholinecarboxylic acid

Purity: 98%

Molecular weight: 231.25g/mol

Ref: 54-OR96802

Morpholine-3,4-dicarboxylic acid 4-tert-butylester

CAS: 212650-43-6

Formula: C₁₀H₁₇NO₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 231.248

Ref: 10-F011824