CAS 21269-78-3
:(1-ethyl-1H-benzimidazol-2-yl)methanol
Description:
(1-Ethyl-1H-benzimidazol-2-yl)methanol, with the CAS number 21269-78-3, is a chemical compound characterized by its unique structure, which includes a benzimidazole ring substituted with an ethyl group and a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of the benzimidazole moiety suggests possible applications in pharmaceuticals, particularly as a scaffold for drug development due to its ability to interact with biological targets. Additionally, the hydroxymethyl group may enhance solubility and reactivity, making it suitable for various chemical reactions. The compound's characteristics, including its melting point, solubility, and reactivity, can vary based on environmental conditions and the presence of other functional groups. Overall, (1-ethyl-1H-benzimidazol-2-yl)methanol represents a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C10H12N2O
InChI:InChI=1/C10H12N2O/c1-2-12-9-6-4-3-5-8(9)11-10(12)7-13/h3-6,13H,2,7H2,1H3
SMILES:CCn1c2ccccc2nc1CO
Synonyms:- 1H-Benzimidazole-2-methanol, 1-ethyl-
- (1-Ethyl-1H-benzimidazol-2-yl)methanol
- (1-ethylbenzimidazol-2-yl)methanol
- (1-ethyl-1H-benzimidazol-2-yl)methanol(SALTDATA: FREE)
- Albb-003786
- (1-Ethyl-1H-benzo[d]imidazol-2-yl)methanol
- 1H-Benzimidazole-2-methanol,1-ethyl-(9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(1-ethyl-1H-benzoimidazol-2-yl)methanol
CAS:Formula:C10H12N2OPurity:97%Color and Shape:SolidMolecular weight:176.2151(1-Ethyl-1H-benzo[d]imidazol-2-yl)methanol
CAS:(1-Ethyl-1H-benzo[d]imidazol-2-yl)methanolPurity:97%Molecular weight:176.22g/mol(1-ethyl-1H-benzimidazol-2-yl)methanol
CAS:Formula:C10H12N2OPurity:97%Color and Shape:Solid, Beige powderMolecular weight:176.2191-Ethyl-2-hydroxymethylbenzimidazole-d5
CAS:Controlled ProductFormula:C10D5H7N2OColor and Shape:NeatMolecular weight:181.246(1-Ethyl-1H-benzimidazol-2-yl)methanol
CAS:Controlled Product(1-Ethyl-1H-benzimidazol-2-yl)methanol is a polymeric brominated derivative of imidazole that is used in the manufacture of hydrobromide and polymerized products. It has been shown to show activity against both gram positive and gram negative bacteria. This compound is also resistant to hydrolysis by esterases, glutathione reductase, cytochrome p450, and mycobacterium.Formula:C10H12N2OPurity:Min. 95%Molecular weight:176.22 g/mol




