CymitQuimica logo

CAS 212710-78-6

:

2,3-Quinoxalinedione, 6,7-dichloro-1,4-dihydro-5-[3-(methoxymethyl)-5-(1-oxido-3-pyridinyl)-4H-1,2,4-triazol-4-yl]-, (-)-

Description:
2,3-Quinoxalinedione, 6,7-dichloro-1,4-dihydro-5-[3-(methoxymethyl)-5-(1-oxido-3-pyridinyl)-4H-1,2,4-triazol-4-yl]-, (-)-, with CAS number 212710-78-6, is a complex organic compound characterized by its unique structural features, including a quinoxalinedione core and multiple functional groups. This substance exhibits a dichloro substitution pattern, which can influence its reactivity and biological activity. The presence of a methoxymethyl group and a pyridine derivative suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The (-) designation indicates that the compound has a specific stereochemistry, which can affect its pharmacological properties. Additionally, the triazole ring contributes to its potential as a bioactive molecule, possibly exhibiting antifungal or antibacterial properties. Overall, this compound's intricate structure and functional groups suggest diverse applications in pharmaceutical research and development.
Formula:C17H12Cl2N6O4
InChI:InChI=1S/C17H12Cl2N6O4/c1-29-7-11-22-23-15(8-3-2-4-24(28)6-8)25(11)14-12(19)9(18)5-10-13(14)21-17(27)16(26)20-10/h2-6H,7H2,1H3,(H,20,26)(H,21,27)
InChI key:InChIKey=IEMAQDHGZOPMNI-UHFFFAOYSA-N
SMILES:C(OC)C=1N(C(=NN1)C2=CN(=O)=CC=C2)C3=C4C(=CC(Cl)=C3Cl)NC(=O)C(=O)N4
Synonyms:
  • 2,3-Quinoxalinedione, 6,7-dichloro-1,4-dihydro-5-[3-(methoxymethyl)-5-(1-oxido-3-pyridinyl)-4H-1,2,4-triazol-4-yl]-, (-)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.