CAS 212713-08-1

Bis(3,5-di-tert-butyl-4-methoxyphenyl)chlorophosphine

Description:

Bis(3,5-di-tert-butyl-4-methoxyphenyl)chlorophosphine is an organophosphorus compound characterized by its unique structure, which includes two bulky 3,5-di-tert-butyl-4-methoxyphenyl groups attached to a phosphorus atom, along with a chlorine substituent. This compound typically exhibits a high degree of steric hindrance due to the presence of the tert-butyl groups, which can influence its reactivity and stability. The methoxy groups contribute to its solubility in organic solvents and may also affect its electronic properties. As a chlorophosphine, it can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal centers, making it of interest in synthetic chemistry and materials science. Its specific applications may vary, but compounds of this nature are often explored for use in catalysis, ligand design, and as intermediates in organic synthesis. Safety and handling precautions should be observed, as organophosphorus compounds can exhibit toxicity and environmental concerns.

Formula: C₃₀H₄₆ClO₂P

InChI: InChI=1/C30H46ClO2P/c1-27(2,3)21-15-19(16-22(25(21)32-13)28(4,5)6)34(31)20-17-23(29(7,8)9)26(33-14)24(18-20)30(10,11)12/h15-18H,1-14H3

SMILES: CC(C)(C)c1cc(cc(c1OC)C(C)(C)C)P(c1cc(c(c(c1)C(C)(C)C)OC)C(C)(C)C)Cl

Synonyms:

• Chloro-Bis(3,5-Ditert-Butyl-4-Methoxy-Phenyl)Phosphane

Bis(3,5-di-tert-butyl-4-methoxyphenyl)chlorophosphine

CAS: 212713-08-1

Formula: C₃₀H₄₆ClO₂P

Purity: 90%

Molecular weight: 505.1118

Ref: IN-DA003O95