CAS 21277-16-7

2-Oxo-4-imidazolidinecarboxylic acid

Description:

2-Oxo-4-imidazolidinecarboxylic acid, also known as L-thiazolidine-4-carboxylic acid, is a heterocyclic organic compound characterized by its imidazolidine ring structure, which contains both a carboxylic acid and a ketone functional group. This compound is typically a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. It is known for its role in biological systems, particularly as a precursor in the synthesis of amino acids and other biologically relevant molecules. The presence of the imidazolidine ring contributes to its unique chemical reactivity, allowing it to participate in various chemical reactions, including cyclization and condensation. Additionally, it has been studied for its potential therapeutic applications, particularly in the field of medicinal chemistry. Its stability and reactivity under different conditions make it an interesting subject for research in organic synthesis and pharmaceutical development.

Formula: C₄H₆N₂O₃

InChI: InChI=1S/C4H6N2O3/c7-3(8)2-1-5-4(9)6-2/h2H,1H2,(H,7,8)(H2,5,6,9)

InChI key: InChIKey=KZKRPYCBSZIQKN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1NC(=O)NC1

Synonyms:

• 2-Imidazolidone-4-carboxylic acid
• 2-Oxo-4-imidazolidinecarboxylic acid
• 2-Oxoimidazolidine-4-Carboxylic Acid
• 4-Imidazolidinecarboxylic acid, 2-oxo-
• 2-Oxo-4-imidazolinecarboxylic acid

2-OXOIMIDAZOLIDINE-4-CARBOXYLIC ACID

CAS: 21277-16-7

Formula: C₄H₆N₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 130.1020

Ref: IN-DA0038W8

2-oxoimidazolidine-4-carboxylic acid

CAS: 21277-16-7

2-oxoimidazolidine-4-carboxylic acid

Purity: 95%

Molecular weight: 130.10g/mol

Ref: 54-OR24950

2-Oxoimidazolidine-4-carboxylic acid

CAS: 21277-16-7

Purity: 97%

Molecular weight: 130.1029968

Ref: 10-F614716

2-Imidazolidone-4-carboxylic acid

CAS: 21277-16-7

2-Imidazolidone-4-carboxylic acid is a potent inhibitor of matrix metalloproteinases, which are enzymes that break down proteins in the extracellular matrix. 2-Imidazolidone-4-carboxylic acid inhibits the activity of both serine protease and matrix metalloproteinase, two enzymes involved in the inflammation process. 2-Imidazolidone-4-carboxylic acid has been shown to inhibit the transport of amino acids, leading to decreased protein synthesis and cell growth. It also inhibits cancer cells by disrupting their ability to grow new blood vessels and invade other tissues.

Formula: C₄H₆N₂O₃

Purity: Min. 95%

Molecular weight: 130.1 g/mol

Ref: 3D-WAA27716