CAS 212779-19-6
:2,3,5-Trichlorobenzeneboronic acid
Description:
2,3,5-Trichlorobenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a chlorinated benzene ring. This compound features three chlorine atoms substituted at the 2, 3, and 5 positions of the benzene ring, which significantly influences its chemical reactivity and properties. The boronic acid group (-B(OH)2) is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and materials science. The presence of chlorine atoms enhances the compound's electrophilicity and can affect its solubility in organic solvents. Typically, boronic acids like this one are utilized in Suzuki coupling reactions, which are essential for forming carbon-carbon bonds in the synthesis of complex organic molecules. Additionally, the compound may exhibit unique properties such as varying degrees of stability and reactivity depending on the reaction conditions and the presence of other functional groups. Overall, 2,3,5-Trichlorobenzeneboronic acid is a versatile intermediate in synthetic organic chemistry.
Formula:C6H4BCl3O2
InChI:InChI=1/C6H4BCl3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,11-12H
SMILES:c1c(cc(c(c1B(O)O)Cl)Cl)Cl
Synonyms:- Thiocarbamoylhydrazine
- (2,3,5-Trichlorophenyl)Boronic Acid
- Boronic acid,B-(2,3,5-trichlorophenyl)-
- 2,3,5-Trichlorophenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,3,5-Trichlorobenzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H4BCl3O2Purity:98%Color and Shape:White to cream to pale yellow, Powder or lumps or fused solidMolecular weight:225.262,3,5-Trichlorophenylboronic acid
CAS:Formula:C6H4BCl3O2Purity:98%Color and Shape:SolidMolecular weight:225.26482,3,5-Trichlorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H4BCl3O2Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:225.262,3,5-Trichlorobenzeneboronic acid
CAS:2,3,5-Trichlorobenzeneboronic acidPurity:98%Molecular weight:225.26g/mol2,3,5-Trichlorophenylboronic acid
CAS:Formula:C6H4BCl3O2Purity:98%Color and Shape:SolidMolecular weight:225.26




