CAS 21278-86-4
:2-(4-Pyridyl)thiazole-4-carboxylic acid
Description:
2-(4-Pyridyl)thiazole-4-carboxylic acid is an organic compound characterized by its unique structural features, which include a thiazole ring and a pyridine moiety. The thiazole ring contributes to its heterocyclic nature, while the carboxylic acid functional group (-COOH) enhances its acidity and solubility in polar solvents. This compound typically exhibits moderate to high polarity due to the presence of both nitrogen and sulfur atoms in the thiazole ring, as well as the carboxylic acid group. It is often used in various chemical syntheses and may serve as a building block in the development of pharmaceuticals or agrochemicals. The compound's ability to form hydrogen bonds due to the carboxylic acid group can influence its reactivity and interactions with other molecules. Additionally, its pyridine and thiazole components may impart biological activity, making it of interest in medicinal chemistry. Overall, 2-(4-Pyridyl)thiazole-4-carboxylic acid is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C9H5N2O2S
InChI:InChI=1/C9H6N2O2S/c12-9(13)7-5-14-8(11-7)6-1-3-10-4-2-6/h1-5H,(H,12,13)/p-1
SMILES:c1cnccc1c1nc(cs1)C(=O)[O-]
Synonyms:- 2-(4-Pyridyl)-1,3-thiazole-4-carboxylic acid
- 2-(Pyridin-4-Yl)-1,3-Thiazole-4-Carboxylic Acid
- 2-Pyridin-4-Yl-1,3-Thiazole-4-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(4-Pyridyl)thiazole-4-carboxylic acid, 97%
CAS:2-(4-Pyridyl)thiazole-4-carboxylic acid, is used as pharmaceutical intermediate and also used in the field of organic synthesis. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacyFormula:C9H5N2O2SPurity:97%Color and Shape:Powder, Cream to pale brownMolecular weight:205.212-(Pyridin-4-yl)-1,3-thiazole-4-carboxylic acid
CAS:Formula:C9H6N2O2SPurity:98%Color and Shape:SolidMolecular weight:206.22112-(Pyridin-4-yl)-1,3-thiazole-4-carboxylic acid
CAS:2-(Pyridin-4-yl)-1,3-thiazole-4-carboxylic acid
Purity:98%Color and Shape:PowderMolecular weight:206.22g/mol2-Pyridin-4-yl-thiazole-4-carboxylic acid
CAS:Formula:C9H6N2O2SPurity:98%Color and Shape:SolidMolecular weight:206.222-(4-Pyridyl)thiazole-4-carboxylic acid
CAS:2-(4-Pyridyl)thiazole-4-carboxylic acid is a supramolecular carboxylate that can form architectures with pyridinium. It has been shown to be able to bind ligands and form polymorphs, which are different crystal structures with the same chemical composition. 2-(4-Pyridyl)thiazole-4-carboxylic acid also forms interdigitated crystals, and its crystal x-ray diffraction pattern has been shown to have diffraction peaks that correspond to divalent conformations. This compound has chiral properties, which means it can exist in two forms that are mirror images of each other. 2-(4-Pyridyl)thiazole-4-carboxylic acid is an isonicotinic acid derivative and can show dihedral angles.Formula:C9H6N2O2SPurity:Min. 95%Molecular weight:206.22 g/mol




