CAS 21279-64-1

5-Chloropyrazine-2-carboxamide

Description:

5-Chloropyrazine-2-carboxamide is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the 5-position and a carboxamide functional group at the 2-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, which can facilitate its use in various chemical reactions and applications. It is often utilized in pharmaceutical research and development due to its potential biological activity, particularly in the synthesis of other compounds or as an intermediate in drug development. The presence of the chlorinated pyrazine structure may impart specific reactivity and biological interactions, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅H₄ClN₃O

InChI: InChI=1/C5H4ClN3O/c6-4-2-8-3(1-9-4)5(7)10/h1-2H,(H2,7,10)

SMILES: c1c(C(=N)O)ncc(Cl)n1

Synonyms:

• 2-Pyrazinecarboxamide, 5-chloro-
• 5-Chloro-2-pyrazinecarboxamide

5-chloropyrazine-2-carboxamide

CAS: 21279-64-1

Formula: C₅H₄ClN₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 157.5578

Ref: IN-DA007QVZ

5-Chloropyrazine-2-carboxamide

CAS: 21279-64-1

5-Chloropyrazine-2-carboxamide

Purity: 98%

Molecular weight: 157.56g/mol

Ref: 54-OR89748

5-Chloropyrazine-2-carboxamide

CAS: 21279-64-1

Formula: C₅H₄ClN₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 157.56

Ref: 10-F077014