CAS 21282-08-6
:pglu-ala
Description:
The chemical substance known as "pglu-ala," with the CAS number 21282-08-6, is a dipeptide composed of two amino acids: phenylalanine (Phe) and alanine (Ala). It is characterized by its specific sequence, where phenylalanine is linked to alanine through a peptide bond. This compound is typically utilized in biochemical research and applications due to its role in protein synthesis and its potential influence on biological processes. Dipeptides like pglu-ala can exhibit various properties, including solubility in water and stability under physiological conditions, depending on their amino acid composition and structure. Additionally, they may possess unique biological activities, such as acting as signaling molecules or influencing metabolic pathways. The study of such dipeptides is essential in understanding protein interactions and functions, as well as in the development of pharmaceuticals and nutraceuticals. Overall, pglu-ala serves as a valuable model for exploring the complexities of peptide chemistry and its implications in biological systems.
Formula:C8H12N2O4
InChI:InChI=1/C8H12N2O4/c1-4(8(13)14)9-7(12)5-2-3-6(11)10-5/h4-5H,2-3H2,1H3,(H,9,12)(H,10,11)(H,13,14)/t4-,5-/m0/s1
SMILES:C[C@@H](C(=O)O)N=C([C@@H]1CCC(=N1)O)O
Synonyms:- Pyr-Ala-OH
- 5-oxo-L-prolyl-L-alanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Pyr-Ala-OH
CAS:Substrate for pyroglutamyl peptidase I.Formula:C8H12N2O4Purity:> 99%Color and Shape:WhiteMolecular weight:200.19L-Alanine,N-(5-oxo-L-prolyl)- (9CI)
CAS:Formula:C8H12N2O4Purity:95%Color and Shape:SolidMolecular weight:200.1919L-Pyroglutamyl-L-Alanine (Pyr-Ala-OH)
CAS:Formula:C8H12N2O4Color and Shape:White To Off-White SolidMolecular weight:200.19((S)-5-Oxopyrrolidine-2-Carbonyl)-L-Alanine
CAS:((S)-5-Oxopyrrolidine-2-Carbonyl)-L-AlaninePurity:95%Molecular weight:200.19g/molL-Pyroglutamyl-L-alanine
CAS:Controlled ProductFormula:C8H12N2O4Color and Shape:NeatMolecular weight:200.192Pyr-Ala
CAS:<p>Pyr-Ala is a peptide that has been shown to be effective in treating inflammatory diseases. It specifically targets the group P2 sequences of the inflammatory cytokine IL-1β. Pyr-Ala also inhibits IL-6 and TNF-α activity by binding to the amide bond of these molecules, inhibiting their catalysis and preventing their formation. Pyr-Ala has also shown efficacy in autoimmune diseases, such as rheumatoid arthritis, by inhibiting the production of proinflammatory cytokines including IL-1β and TNF-α. This drug binds to the bacterial enzyme that catalyzes the conversion of L -alanine into pyruvic acid, preventing its function and inhibiting bacterial growth.</p>Formula:C8H12N2O4Purity:Min. 95%Molecular weight:200.19 g/mol







