CAS 212844-53-6: Purvalanol A
Description:Purvalanol A is a selective inhibitor of cyclin-dependent kinases (CDKs), particularly CDK2 and CDK1, which play crucial roles in cell cycle regulation. This compound is characterized by its ability to interfere with the phosphorylation of target proteins, thereby influencing cellular proliferation and apoptosis. Purvalanol A is often utilized in research settings to study cell cycle dynamics and the effects of CDK inhibition on cancer cell growth. It is typically presented as a white to off-white solid and is soluble in organic solvents such as DMSO. The compound has a molecular formula that reflects its complex structure, which includes multiple functional groups that contribute to its biological activity. Due to its specificity and potency, Purvalanol A serves as a valuable tool in pharmacological studies and has potential implications in cancer therapy, where modulation of CDK activity can lead to therapeutic benefits. However, as with any chemical substance, proper handling and safety protocols should be observed during its use in laboratory settings.
Formula:C19H25ClN6O
InChI:InChI=1S/C19H25ClN6O/c1-11(2)15(9-27)23-19-24-17(22-14-7-5-6-13(20)8-14)16-18(25-19)26(10-21-16)12(3)4/h5-8,10-12,15,27H,9H2,1-4H3,(H2,22,23,24,25)/t15-/m0/s1
InChI key:InChIKey=PMXCMJLOPOFPBT-HNNXBMFYSA-N
SMILES:ClC1=CC=CC(=C1)NC2=NC(=NC3=C2N=CN3C(C)C)NC(CO)C(C)C
- Synonyms:
- (2R)-2-({6-[(3-Chlorophenyl)amino]-9-isopropyl-9H-purin-2-yl}amino)-3-methylbutan-1-ol
- (2R)-2-[[6-(3-Chloroanilino)-9-isopropyl-purin-2-yl]amino]-3-methyl-butan-1-ol
- (2R)-2-[[6-(3-Chloroanilino)-9-propan-2-ylpurin-2-yl]amino]-3-methylbutan-1-ol
- (2R)-2-[[6-[(3-Chlorophenyl)amino]-9-(1-methylethyl)-9H-purin-2-yl]amino]-3-methyl-1-butanol
- (R)-Purvalanol A
- 1-Butanol, 2-[[6-[(3-chlorophenyl)amino]-9-(1-methylethyl)-9H-purin-2-yl]amino]-3-methyl-, (2R)-
- Ng 60
- Purvalanol A
