CAS 2128735-29-3

4,7,13,16-Tetraoxa-10-azanonadecanedioic acid, 10-[4-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-1,4-dioxobutyl]-, 1,19-bis(2,5-dioxo-1-pyrrolidinyl) ester

Description:

4,7,13,16-Tetraoxa-10-azanonadecanedioic acid, 10-[4-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-1,4-dioxobutyl]-, 1,19-bis(2,5-dioxo-1-pyrrolidinyl) ester, identified by CAS number 2128735-29-3, is a complex organic compound characterized by its multi-functional groups and structural intricacies. This substance features a long carbon chain with multiple oxygen atoms incorporated into its structure, indicating the presence of ether and ester functionalities. The presence of a nitrogen atom suggests potential basic properties, while the dioxo and pyrrolidinyl groups may contribute to its reactivity and solubility in various solvents. The compound's unique structure may impart specific biological activities or interactions, making it of interest in pharmaceutical or materials science applications. Its synthesis likely involves advanced organic chemistry techniques, and its stability, solubility, and reactivity would depend on the specific conditions under which it is handled. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₄₁H₄₆N₄O₁₄

InChI: InChI=1S/C41H46N4O14/c46-34(11-12-35(47)43-29-32-7-2-1-5-30(32)9-10-31-6-3-4-8-33(31)43)42(19-23-56-27-25-54-21-17-40(52)58-44-36(48)13-14-37(44)49)20-24-57-28-26-55-22-18-41(53)59-45-38(50)15-16-39(45)51/h1-8H,11-29H2

InChI key: InChIKey=KUJNKGPVOIXRHI-UHFFFAOYSA-N

SMILES: C(CCC(N(CCOCCOCCC(ON1C(=O)CCC1=O)=O)CCOCCOCCC(ON2C(=O)CCC2=O)=O)=O)(=O)N3C=4C(C#CC=5C(C3)=CC=CC5)=CC=CC4

Synonyms:

• 4,7,13,16-Tetraoxa-10-azanonadecanedioic acid, 10-[4-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-1,4-dioxobutyl]-, 1,19-bis(2,5-dioxo-1-pyrrolidinyl) ester
• N-DBCO-N-bis(PEG2-C2-NHS ester)
• N-DBCO-N-bis(PEG2-NHS ester)

N-DBCO-N-bis(PEG2-NHS ester)

CAS: 2128735-29-3

Formula: C₄₁H₄₆N₄O₁₄

Purity: 96%

Molecular weight: 818.8223

Ref: IN-DA019EFG

N-DBCO-N-bis(PEG2-C2-NHS ester)

CAS: 2128735-29-3

N-DBCO-N-bis(PEG2-C2-NHS ester) is a PEG-like PROTAC linker , and also contains a DBCO moiety for click chemistry with azide groups.

Formula: C₄₁H₄₆N₄O₁₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 818.82

Ref: TM-T18410

N-DBCO-N-bis(PEG2-C2-NHS ester)

CAS: 2128735-29-3

N-DBCO-N-bis(PEG2-C2-NHS ester)

Purity: 96%

Molecular weight: 818.82g/mol

Ref: 54-OR1034746

N-DBCO-N-bis(PEG2-C2-NHS ester)

CAS: 2128735-29-3

Purity: 96%

Molecular weight: 818.833

Ref: 10-F986477