CAS 21291-36-1
:2,5-anhydro-5-(hydroxymethyl)-alpha-D-gluco-D-manno-undec-6-ulopyranosyl alpha-D-glucopyranoside
Description:
2,5-Anhydro-5-(hydroxymethyl)-alpha-D-gluco-D-manno-undec-6-ulopyranosyl alpha-D-glucopyranoside, with the CAS number 21291-36-1, is a complex carbohydrate derivative. This compound features a unique structure characterized by an anhydro sugar moiety, which contributes to its stability and reactivity. The presence of hydroxymethyl groups indicates potential for hydrogen bonding, influencing its solubility and interaction with other molecules. As a glycoside, it likely exhibits properties typical of sugars, such as sweetness and solubility in water. Its structural complexity suggests potential applications in biochemistry, particularly in studies related to carbohydrate metabolism or as a building block in synthetic chemistry. The compound may also possess biological activity, making it of interest in pharmaceutical research. However, specific characteristics such as melting point, solubility, and reactivity would require empirical data for precise evaluation. Overall, this substance exemplifies the intricate nature of carbohydrate chemistry and its relevance in various scientific fields.
Formula:C18H32O16
InChI:InChI=1/C18H32O16/c19-1-5-8(23)11(26)13(28)16(31-5)34-18(15(30)12(27)9(24)6(2-20)33-18)17(4-22)14(29)10(25)7(3-21)32-17/h5-16,19-30H,1-4H2/t5-,6-,7-,8-,9-,10-,11+,12+,13-,14+,15-,16-,17+,18+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.


