CAS 21294-14-4
:1,2-Bis(aminomethyl)benzene dihydrochloride
Description:
1,2-Bis(aminomethyl)benzene dihydrochloride, also known as 1,2-bis(aminomethyl)benzene dihydrochloride, is an organic compound characterized by its structure, which features a benzene ring with two aminomethyl groups attached to adjacent carbon atoms. This compound is typically encountered as a dihydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in chemical synthesis and research. It is a white to off-white crystalline solid, and its properties include being hygroscopic and having a relatively high melting point. The presence of amino groups makes it a potential candidate for use in the synthesis of polymers, pharmaceuticals, and as a ligand in coordination chemistry. Additionally, due to its amine functionality, it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety precautions should be taken when handling this compound, as it may cause irritation to the skin, eyes, and respiratory system.
Formula:C8H12N2ClH
InChI:InChI=1S/C8H12N2.2ClH/c9-5-7-3-1-2-4-8(7)6-10;;/h1-4H,5-6,9-10H2;2*1H
SMILES:c1ccc(CN)c(c1)CN.Cl.Cl
Synonyms:- 1,2-Benzenedimethanamine, dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,2-Phenylenedimethanamine dihydrochloride
CAS:Formula:C8H14Cl2N2Purity:95%Color and Shape:SolidMolecular weight:209.1162[2-(Aminomethyl)phenyl]methanamine dihydrochloride
CAS:[2-(Aminomethyl)phenyl]methanamine dihydrochloridePurity:95%Color and Shape:SolidMolecular weight:209.12g/mol1,2-Phenylenedimethanamine dihydrochloride
CAS:1,2-Phenylenedimethanamine dihydrochloride is a colorless to white crystalline solid that is soluble in diethyl ether, ethyl acetate and methanol. It is insoluble in water and most organic solvents. 1,2-Phenylenedimethanamine dihydrochloride is used as a reagent for the preparation of primary amines from alkyl halides. This chemical has been shown to be stable in air and remains unchanged when heated at 100°C. Synonyms include: 2-Amino-1,2-phenylene dichloride; 2-Amino-1,2-diphenylethane dichloride; 2-[(1,2)-Phenylenebis(amino)]dichloroethene; 2-[(1,2)-Phenylenebis(amino)]dichloroethene; and PhenFormula:C8H14Cl2N2Purity:Min. 95%Color and Shape:PowderMolecular weight:209.12 g/mol1,2-Phenylenedimethanamine dihydrochloride
CAS:Formula:C8H14Cl2N2Purity:95%Color and Shape:SolidMolecular weight:209.11



