CAS 2130-17-8

Tetrahymanol

Description:

Tetrahymanol is a chemical compound classified as a triterpenoid, specifically a type of sterol. It is primarily derived from certain species of algae and is notable for its role in the biosynthesis of sterols in various organisms. The molecular structure of tetrahymanol features a tetracyclic framework, which is characteristic of many triterpenes, and it possesses multiple functional groups that contribute to its chemical reactivity and biological activity. This compound is of interest in biochemistry and environmental science due to its potential applications in understanding lipid metabolism and its role in the evolutionary history of sterols. Tetrahymanol has been studied for its implications in the fossil record, as it can serve as a biomarker for ancient algal life. Additionally, it may exhibit various biological activities, although specific pharmacological properties require further investigation. Overall, tetrahymanol represents a significant compound in the study of natural products and their ecological and evolutionary significance.

Formula: C₃₀H₅₂O

InChI: InChI=1S/C30H52O/c1-25(2)15-9-16-27(5)20(25)12-18-29(7)22(27)10-11-23-28(6)17-14-24(31)26(3,4)21(28)13-19-30(23,29)8/h20-24,31H,9-19H2,1-8H3/t20-,21-,22+,23+,24-,27-,28-,29+,30+/m0/s1

InChI key: InChIKey=BFNSRKHIVITRJP-VJBYBJRLSA-N

SMILES: C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@@H](O)CC3)[H])(CC[C@]4([C@@]2(C)CC[C@@]5([C@]4(C)CCCC5(C)C)[H])[H])[H]

Synonyms:

• (21alpha)-Gammaceran-21-ol
• (3S,4aR,6aR,6bR,8aS,12aS,12bR,14aR,14bR)-4,4,6a,6b,9,9,12a,14b-Octamethyldocosahydro-3-picenol
• (3β)-Gammaceran-3-ol
• Gammaceran-21-Ol, (21Alpha)-
• Gammaceran-3-Ol, (3Beta)-
• Gammaceran-3-ol, (3β)-
• Gammaceran-3β-ol
• Tetrahymanol
• Wallichiniol
• (3beta)-Gammaceran-3-ol

Tetrahymanol

CAS: 2130-17-8

Formula: C₃₀H₅₂O

Purity: 95%~99%

Molecular weight: 428.745

Ref: BP-SBP04438

Tetrahymanol

CAS: 2130-17-8

Tetrahymanol is a cyclic triterpenoid present in Tetrahymena pyriformis and marine sediments that does not require molecular oxygen.

Formula: C₃₀H₅₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 428.73

Ref: TM-TN5136

Tetrahymanol

CAS: 2130-17-8

Tetrahymanol is a pentacyclic triterpenoid hydrocarbon, which is isolated from various eukaryotic microorganisms, including certain protozoa and bacteria. These organisms naturally biosynthesize tetrahymanol as part of their membranes, where it plays a crucial role in modulating membrane fluidity and integrity. The mode of action of tetrahymanol involves its incorporation into the cell membrane, where it interacts with lipid bilayers, affecting their organization and dynamics. This interaction is essential for maintaining cell membrane stability under varying environmental conditions.

Formula: C₃₀H₅₂O

Purity: Min. 95%

Molecular weight: 428.70 g/mol

Ref: 3D-CAA13017