CAS 213024-76-1

7-amino-5-methyl-5,7-dihydro-6H-dibenzo[b,d]azepin-6-one

Description:

7-amino-5-methyl-5,7-dihydro-6H-dibenzo[b,d]azepin-6-one is a chemical compound characterized by its complex bicyclic structure, which includes a dibenzoazepine core. This compound features an amino group and a methyl group, contributing to its unique reactivity and potential biological activity. The presence of the carbonyl group (ketone) in the structure indicates that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The compound's molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders, given the structural similarities to other bioactive compounds. Its CAS number, 213024-76-1, allows for precise identification in chemical databases and literature. The compound's solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it essential to consider these factors in practical applications. Overall, 7-amino-5-methyl-5,7-dihydro-6H-dibenzo[b,d]azepin-6-one represents a significant structure in the realm of organic and medicinal chemistry.

Formula: C₁₅H₁₄N₂O

InChI: InChI=1/C15H14N2O/c1-17-13-9-5-4-7-11(13)10-6-2-3-8-12(10)14(16)15(17)18/h2-9,14H,16H2,1H3

SMILES: CN1c2ccccc2c2ccccc2C(C1=O)N

Synonyms:

• 7-Amino-5-methyl-5,7-dihydro-6H-dibenzo[b,d]azepin-6-on

6H-Dibenz[b,d]azepin-6-one, 7-amino-5,7-dihydro-5-methyl-

CAS: 213024-76-1

Formula: C₁₅H₁₄N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 238.2845

Ref: IN-DA00BF1O

7-Amino-5-methyl-5H-dibenzo[b,d]azepin-6(7H)-one

CAS: 213024-76-1

7-Amino-5-methyl-5H-dibenzo[b,d]azepin-6(7H)-one

Purity: 98%

Molecular weight: 238.28g/mol

Ref: 54-OR89166

7-Amino-5-methyl-5H-dibenzo[b,d]azepin-6(7H)-one

CAS: 213024-76-1

Purity: 97%

Molecular weight: 238.2899932861328

Ref: 10-F787858