CymitQuimica logo

CAS 2130896-19-2

:

5-Chloro-6-(morpholino)pyridine-3-boronic acid

Description:
5-Chloro-6-(morpholino)pyridine-3-boronic acid is a chemical compound characterized by its boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, particularly in medicinal chemistry and organic synthesis. The presence of the chloro substituent on the pyridine ring enhances its reactivity and potential for further functionalization. The morpholino group contributes to the compound's solubility and may influence its biological activity, as morpholine derivatives are often associated with improved pharmacokinetic properties. This compound is typically utilized in the development of pharmaceuticals, particularly in the synthesis of kinase inhibitors and other therapeutic agents. Its boronic acid moiety also allows for participation in Suzuki coupling reactions, a key method in constructing carbon-carbon bonds in organic synthesis. Overall, 5-Chloro-6-(morpholino)pyridine-3-boronic acid is a versatile building block in chemical research and drug development, with properties that facilitate its use in various synthetic pathways.
Formula:C9H12BClN2O3
InChI:InChI=1S/C9H12BClN2O3/c11-8-5-7(10(14)15)6-12-9(8)13-1-3-16-4-2-13/h5-6,14-15H,1-4H2
InChI key:MWNZQPQVKHVBEP-UHFFFAOYSA-N
SMILES:B(C1=CC(=C(N=C1)N2CCOCC2)Cl)(O)O
Synonyms:
  • 5-Chloro-6-(morpholino)pyridine-3-boronic acid
Found 3 products.