CAS 21312-41-4

4-[(4-aminophenyl)carbonyl]-1-ethylpiperazin-1-ium

Description:

4-[(4-Aminophenyl)carbonyl]-1-ethylpiperazin-1-ium, with the CAS number 21312-41-4, is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This substance features an ethyl group attached to the nitrogen of the piperazine ring, enhancing its solubility and biological activity. The presence of a carbonyl group linked to a para-aminophenyl moiety indicates potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions. The quaternization of the piperazine nitrogen contributes to its ionic nature, which can influence its interaction with biological systems, potentially enhancing its pharmacological properties. This compound may exhibit properties such as antimicrobial or antitumor activity, although specific biological effects would depend on further empirical studies. Its structural characteristics suggest it could be soluble in polar solvents, and its stability would be influenced by environmental factors such as pH and temperature. Overall, this compound's unique structure positions it as a subject of interest in medicinal chemistry and drug development.

Formula: C₁₃H₂₀N₃O

InChI: InChI=1/C13H19N3O/c1-2-15-7-9-16(10-8-15)13(17)11-3-5-12(14)6-4-11/h3-6H,2,7-10,14H2,1H3/p+1

Methanone,(4-aminophenyl)(4-ethyl-1-piperazinyl)-

CAS: 21312-41-4

Formula: C₁₃H₁₉N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 233.3095

Ref: IN-DA0072YP

(4-Aminophenyl)(4-Ethylpiperazin-1-Yl)Methanone

CAS: 21312-41-4

(4-Aminophenyl)(4-Ethylpiperazin-1-Yl)Methanone

Purity: 95%

Molecular weight: 233.31g/mol

Ref: 54-OR1027320

(4-Amino-phenyl)-(4-ethyl-piperazin-1-yl)-methanone

CAS: 21312-41-4

Formula: C₁₃H₁₉N₃O

Purity: 95%

Molecular weight: 233.315

Ref: 10-F030810