CymitQuimica logo

CAS 213130-43-9

:

3-chloro-4-cyanobenzenesulfonyl chloride

Description:
3-Chloro-4-cyanobenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides. This compound features a chlorinated aromatic ring, with a chlorine atom and a cyano group (-CN) positioned at the 3 and 4 positions, respectively, relative to the sulfonyl chloride group. The presence of the cyano group contributes to its electron-withdrawing properties, enhancing its reactivity in nucleophilic substitution reactions. The sulfonyl chloride moiety makes it a valuable intermediate in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals. It is typically a solid at room temperature and may be sensitive to moisture, requiring careful handling and storage. Safety precautions are essential due to its potential to release toxic gases upon hydrolysis. Overall, 3-chloro-4-cyanobenzenesulfonyl chloride is a versatile reagent in synthetic organic chemistry, facilitating the introduction of sulfonyl groups into various substrates.
Formula:C7H3Cl2NO2S
InChI:InChI=1/C7H3Cl2NO2S/c8-7-3-6(13(9,11)12)2-1-5(7)4-10/h1-3H
InChI key:HWCNCOCJCVWMBX-UHFFFAOYSA-N
SMILES:c1cc(cc(c1C#N)Cl)S(=O)(=O)Cl
Synonyms:
  • 3-Chloro-4-Cyanobenzene-1-Sulfonyl Chloride
  • Benzenesulfonyl Chloride, 3-Chloro-4-Cyano-
Found 5 products.