CAS 213133-77-8

2-(3,4-Dichlorobenzyl)1H Benzimidazole

Description:

2-(3,4-Dichlorobenzyl)-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a 3,4-dichlorobenzyl group. This compound typically exhibits properties associated with both the benzimidazole and chlorobenzyl moieties, such as potential biological activity and solubility characteristics influenced by its halogen substituents. The presence of chlorine atoms can enhance lipophilicity and may contribute to its reactivity and interaction with biological targets. It is often studied for its pharmacological properties, including antifungal and antibacterial activities. The compound's molecular structure allows for various interactions, making it a subject of interest in medicinal chemistry. Safety and handling precautions are essential when working with this substance, as with many organic compounds, due to potential toxicity and environmental impact. Overall, 2-(3,4-Dichlorobenzyl)-1H-benzimidazole represents a significant compound in the field of organic chemistry and drug development.

Formula: C₉H₈BrFO

InChI: InChI=1/C9H8BrFO/c1-2-9(12)6-3-7(10)5-8(11)4-6/h3-5H,2H2,1H3

SMILES: CCC(=O)c1cc(cc(c1)F)Br

Synonyms:

• 1H-Benzimidazole, 2-[(3,4-dichlorophenyl)methyl]-
• Tcmdc-125878
• 2-(3,4-Dichlorobenzyl)-1H-benzo[d]imidazole

2-(3,4-Dichlorobenzyl)-1H-benzo[d]imidazole

CAS: 213133-77-8

Formula: C₁₄H₁₀Cl₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 277.1486

Ref: IN-DA007QUH

2-(3,4-Dichlorobenzyl)-1H-Benzo[d]Imidazole

CAS: 213133-77-8

2-(3,4-Dichlorobenzyl)-1H-Benzo[d]Imidazole

Purity: 99%

Molecular weight: 277.15g/mol

Ref: 54-OR1009710

2-(3,4-Dichlorobenzyl)-1H-benzo[d]imidazole

CAS: 213133-77-8

Purity: 95.0%

Molecular weight: 277.1499938964844

Ref: 10-F240567