
CAS 21316-80-3
:3-(1,1-Dimethyl-2-propen-1-yl)-7-hydroxy-6-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-2-one
Description:
The chemical substance known as "3-(1,1-Dimethyl-2-propen-1-yl)-7-hydroxy-6-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-2-one," with the CAS number 21316-80-3, is a flavonoid compound characterized by its complex polycyclic structure. This compound features a benzopyran backbone, which is typical of flavonoids, and is substituted with various alkyl groups that contribute to its unique properties. The presence of hydroxyl groups enhances its potential antioxidant activity, making it of interest in various biological and pharmacological studies. Its structural features suggest that it may exhibit significant biological activities, including anti-inflammatory and anticancer properties. Additionally, the presence of multiple double bonds in its side chains may influence its reactivity and stability. This compound is often studied for its potential applications in natural product chemistry and medicinal chemistry, particularly in the development of new therapeutic agents. Overall, its intricate structure and functional groups make it a subject of interest in both synthetic and natural product research.
Formula:C19H22O3
InChI:InChI=1S/C19H22O3/c1-6-19(4,5)15-10-14-9-13(8-7-12(2)3)16(20)11-17(14)22-18(15)21/h6-7,9-11,20H,1,8H2,2-5H3
InChI key:InChIKey=HEPYYVMIJBDNIM-UHFFFAOYSA-N
SMILES:C(C=C)(C)(C)C1=CC=2C(OC1=O)=CC(O)=C(CC=C(C)C)C2
Synonyms:- Gravelliferone
- 2H-1-Benzopyran-2-one, 3-(1,1-dimethyl-2-propenyl)-7-hydroxy-6-(3-methyl-2-butenyl)-
- Coumarin, 3-(1,1-dimethylallyl)-7-hydroxy-6-(3-methyl-2-butenyl)-
- 3-(1,1-Dimethyl-2-propen-1-yl)-7-hydroxy-6-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-2-one
- 2H-1-Benzopyran-2-one, 3-(1,1-dimethyl-2-propen-1-yl)-7-hydroxy-6-(3-methyl-2-buten-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Gravelliferone
CAS:Gravelliferone is a useful organic compound for research related to life sciences. The catalog number is T125348 and the CAS number is 21316-80-3.Formula:C19H22O3Color and Shape:SolidMolecular weight:298.382
