CAS 213181-24-9

ethyl 7-chloro-5-oxo-2,3-dihydro-1H,5H-pyrido[3,2,1-ij]quinoline-6-carboxylate

Description:

Ethyl 7-chloro-5-oxo-2,3-dihydro-1H,5H-pyrido[3,2,1-ij]quinoline-6-carboxylate is a complex organic compound characterized by its unique bicyclic structure, which incorporates both a pyridine and a quinoline moiety. This compound features a chloro substituent and a carboxylate ester group, contributing to its chemical reactivity and potential biological activity. The presence of the carbonyl group (5-oxo) indicates a ketone functionality, which can participate in various chemical reactions, such as nucleophilic attacks. The ethyl ester group enhances its solubility in organic solvents, making it suitable for various applications in medicinal chemistry and drug development. Its structural complexity suggests potential pharmacological properties, possibly as an antimicrobial or anticancer agent, although specific biological activities would require further investigation. The compound's CAS number, 213181-24-9, allows for easy identification and reference in chemical databases, facilitating research and development efforts in related fields.

Formula: C₁₅H₁₄ClNO₃

InChI: InChI=1/C15H14ClNO3/c1-2-20-15(19)11-12(16)10-7-3-5-9-6-4-8-17(13(9)10)14(11)18/h3,5,7H,2,4,6,8H2,1H3

SMILES: CCOC(=O)c1c(c2cccc3CCCn(c23)c1=O)Cl

ethyl 7-chloro-5-oxo-2,3-dihydro-1H,5H-pyrido[3,2,1-ij]quinoline-6-carboxylate

CAS: 213181-24-9

ethyl 7-chloro-5-oxo-2,3-dihydro-1H,5H-pyrido[3,2,1-ij]quinoline-6-carboxylate

Purity: ≥95%

Molecular weight: 291.73g/mol

Ref: 54-OR22798