CymitQuimica logo

CAS 21320-62-7

:

4-chloro-6-methyl-1,3,5-triazin-2-amine

Description:
4-Chloro-6-methyl-1,3,5-triazin-2-amine, with the CAS number 21320-62-7, is a heterocyclic organic compound characterized by its triazine ring structure, which consists of three nitrogen atoms and three carbon atoms. This compound features a chlorine atom and a methyl group attached to the triazine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. The presence of the amino group (-NH2) makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is of interest in agricultural chemistry, particularly as a herbicide or in the synthesis of other agrochemicals. Its reactivity and stability can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use and storage.
Formula:C4H5ClN4
InChI:InChI=1/C4H5ClN4/c1-2-7-3(5)9-4(6)8-2/h1H3,(H2,6,7,8,9)
InChI key:BTBXQZKDOSYRDX-UHFFFAOYSA-N
SMILES:Cc1nc(Cl)nc(=N)[nH]1
Found 4 products.