CAS 21323-71-7

7-chloro-3-methyl-3H-[1,2,3]triazolo[4,5-d]pyrimidine

Description:

7-Chloro-3-methyl-3H-[1,2,3]triazolo[4,5-d]pyrimidine is a heterocyclic compound characterized by its unique triazole and pyrimidine ring structures. This compound features a chlorine atom at the 7-position and a methyl group at the 3-position of the triazole ring, contributing to its chemical reactivity and potential biological activity. The presence of the triazole moiety often imparts interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound is typically synthesized through various organic reactions, including cyclization processes that form the triazole and pyrimidine rings. Its solubility and stability can vary depending on the solvent and conditions used, which is crucial for its application in research and development. Additionally, the compound may exhibit antimicrobial or antitumor activities, making it a candidate for further investigation in drug discovery. As with many heterocycles, its properties can be influenced by substituents and the overall molecular structure, leading to diverse applications in pharmaceuticals and agrochemicals.

Formula: C₅H₄ClN₅

InChI: InChI=1/C5H4ClN5/c1-11-5-3(9-10-11)4(6)7-2-8-5/h2H,1H3

SMILES: Cn1c2c(c(Cl)ncn2)nn1

Synonyms:

• 3H-1,2,3-triazolo[4,5-d]pyrimidine, 7-chloro-3-methyl-
• 7-chloro-3-methyl-3H-1,2,3-triazolo(4,5-d)pyrimidine
• 7-Chloro-3-methyl-3H-[1,2,3]triazolo[4,5-d]pyrimidine
• 7-Chloro-3-methyl-3H-1,2,3-triazolo[4,5-d]pyrimidine
• 7-Chloro-3-methyl-triazolo[4,5-d]pyrimidine

7-Chloro-3-methyl-3H-1,2,3-triazolo[4,5-d]pyrimidine

CAS: 21323-71-7

Formula: C₅H₄ClN₅

Color and Shape: Solid

Molecular weight: 169.5718

Ref: IN-DA00BHKL

7-Chloro-3-methyl-3H-1,2,3-triazolo[4,5-d]pyrimidine

CAS: 21323-71-7

Formula: C₅H₄ClN₅

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 169.57

Ref: 10-F076381

7-Chloro-3-methyl-3H-1,2,3-triazolo[4,5-d]pyrimidine

CAS: 21323-71-7

7-Chloro-3-methyl-3H-1,2,3-triazolo[4,5-d]pyrimidine is an active methylene compound that belongs to the group of tautomeric compounds. It is a pyrimidine derivative and a sodium salt of the amine. 7-Chloro-3-methyl-3H-1,2,3-triazolo[4,5-d]pyrimidine can be prepared from 2,4,6,-trichloropyrimidine by adding sodium hydride in dimethylformamide. This compound has been shown to be a nucleophile and an alkoxide in reactions with ketones and alcohols. 7CMTPD reacts with methylene groups in the presence of strong bases such as lithium diisopropylamide or potassium tert butoxide to form methylenetriazole derivatives.
7CMTPD can also react with nucleophiles

Purity: Min. 95%

Ref: 3D-NC44308