CymitQuimica logo

CAS 21324-99-2

:

(2E)-dibenzo[b,e]oxepin-11(6H)-ylideneethanal

Description:
(2E)-Dibenzo[b,e]oxepin-11(6H)-ylideneethanal, with CAS number 21324-99-2, is a chemical compound characterized by its unique structure, which includes a dibenzo[b,e]oxepin core fused with a ylideneethanal moiety. This compound features a conjugated system that contributes to its potential reactivity and stability. The presence of the ylideneethanal group suggests that it may exhibit properties typical of aldehydes, such as reactivity towards nucleophiles. Additionally, the dibenzooxepin structure may impart specific electronic and steric properties, influencing its interactions in chemical reactions. The compound may also exhibit interesting photophysical properties due to its conjugated nature, making it of interest in fields such as organic electronics or materials science. Its potential applications could extend to medicinal chemistry, where derivatives of such structures are often explored for biological activity. However, detailed studies on its specific reactivity, stability, and biological properties would be necessary to fully understand its characteristics and potential uses.
Formula:C16H12O2
InChI:InChI=1/C16H12O2/c17-10-9-14-13-6-2-1-5-12(13)11-18-16-8-4-3-7-15(14)16/h1-10H,11H2/b14-9+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.