CAS 213252-19-8
:5-[(2,4-Dioxo-5-thiazolidinyl)methyl]-2-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide
Description:
The chemical substance known as 5-[(2,4-Dioxo-5-thiazolidinyl)methyl]-2-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide, with the CAS number 213252-19-8, exhibits several notable characteristics. It is a synthetic compound that belongs to the class of thiazolidinones, which are known for their diverse biological activities, including potential anti-inflammatory and antidiabetic properties. The presence of the thiazolidinone moiety contributes to its reactivity and interaction with biological targets. The compound features a methoxy group and a trifluoromethyl-substituted phenyl ring, which can enhance its lipophilicity and influence its pharmacokinetic properties. Additionally, the dioxo group in the thiazolidinyl structure may play a role in its ability to form hydrogen bonds, potentially affecting its binding affinity to target proteins. Overall, this compound's unique structural features suggest it may have significant implications in medicinal chemistry and drug development, although specific biological activities and mechanisms would require further investigation.
Formula:C20H17F3N2O4S
InChI:InChI=1S/C20H17F3N2O4S/c1-29-15-7-4-12(9-16-18(27)25-19(28)30-16)8-14(15)17(26)24-10-11-2-5-13(6-3-11)20(21,22)23/h2-8,16H,9-10H2,1H3,(H,24,26)(H,25,27,28)
InChI key:InChIKey=NFFXEUUOMTXWCX-UHFFFAOYSA-N
SMILES:C(NCC1=CC=C(C(F)(F)F)C=C1)(=O)C2=C(OC)C=CC(CC3SC(=O)NC3=O)=C2
Synonyms:- (±)-5-[(2,4-dioxothiazolidin-5-yl)methyl]-2-methoxy-N-[[(4-trifluoromethyl)phenyl]methyl]benzamide
- 213252-19-8
- 5-[(2,4-Dioxo-5-thiazolidinyl)methyl]-2-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide
- Krp 297
- Krp297
- Mk 767
- benzamide, 5-[(2,4-dioxo-5-thiazolidinyl)methyl]-2-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
KRP-297
CAS:<p>KRP297 is a PPAR agonist potentially for the treatment of type 2 diabetes and dyslipidemia.</p>Formula:C20H17F3N2O4SColor and Shape:SolidMolecular weight:438.42
